|
|
|
Dayang Chem (Hangzhou) Co.,Ltd.is a supplier of
|
_Co_Ltd_1_575.jpg "Dayang Chem (Hangzhou) Co.,Ltd.") |
p-Acetotoluidine |
|
|
This listing includes other chemicals and chemical products supplied by Dayang Chem (Hangzhou) Co.,Ltd..
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Dayang Chem (Hangzhou) Co.,Ltd. |
Dayang Chem (Hangzhou) Co.,Ltd. is a comprehensive entity which specializes in development, production and trade of pharmaceutical, agrochemical and dyestuff intermediates as well as some special type reagents. We have an own factory and share enterprises. We act also as agent of many chemical factories and promote their products to the international market at very competitive price.
We take "Credi first, Clients supreme" as our aim. We expect to cooperate with more partners in the world by providing superior quality chemicals and best service.
|
|
Dayang Chem (Hangzhou) Co.,Ltd. also offers: p-Acetoacetanisidide p-(tert-Butyldimethylsiloxy)styrene p-(tert-Butyl)phenethyldimethylchlorosilane p-(Phenylazo)benzyl chloroformate p-(n-Dodecyl)benzoic acid p-(Isopentyl)benzaldehyde p-(Hexyloxy)cinnamic acid p-(Dimethylamino)phenol hydrochloride p-(Dimethoxymethyl)toluene p-(beta-Bromoethyl)acetophenone p-(Benzylsulfonamido)benzoic acid p-(4,5-Dihydro-3-methyl-1H-pyrazol-1-yl)benzenesulfonic acid p-(3-Hydrazino-3-oxopropoxy)benzohydrazide P-(3-Bromopropyl)phosphonic acid diethyl ester p-(2-N-Aminoethyl)benzene sulfonamide hydrochloride p-(2-Chloro)ethyl anisol P-(2,5-dichlorophenyl)phosphonic acid p-(1-Methyloctyl)phenol p-(1-Adamantyl)toluene p-(1,1-Dimethylheptyl)phenol p-((p-Methoxyphenyl)azo)phenol P,p'-[p-phenylenebis(azo)]bisphenol p,p'-Oxy-bis-(benzene sulfonyl hydrazide) P(3HB-co-4HB) Ozagrel sodium Ozagrel methyl ester Ozagrel hydrochloride Oxytocin acetate Oxytocin (free acid) Oxythiamine hydrochloride Oxytetracycline hydrochloride Oxytetracycline 2-hydrate Oxysophocarpine Oxyresveratrol Oxyphenyl butazone Oxyphenonium bromide Oxyphenisatin Oxyphencyclimine hydrochloride Oxyphenbutazone hydrate Oxypeucedanin Oxyfluorfen Oxydipropylene dilaurate Oxydiethylene dinitrate Oxydiethylene bis[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate] Oxyclozanide Oxychelerythrine Oxycarboxin Oxybutynin hydrochloride Oxybuprocain hydrochloride Oxybis[2,2-bis[[(1-oxoisodecyl)oxy]methyl]-3,1-propanediyl] diisodecanoate
|
|
|
| p-Acetotoluidine is offered by other companies |
Shandong Ench Chemical Co.,Ltd
|
Simagchem Corporation
|
Hangzhou Lingrui Chemical Co., Ltd.
|
Xiamen Equation Chemical Co.,Ltd
|
Leap Chem Co., Ltd
|
|
|
|
|
|